C15H14F3NO7S2 — CID 67988372
N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfonyl-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 67988372) has the molecular formula C15H14F3NO7S2 and a molecular weight of 441.41 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfonyl-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfonyl-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 67988372 |
| Molecular Formula | C15H14F3NO7S2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfonyl-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cc(S(=O)(=O)NCc2ccc(O)c(O)c2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C15H14F3NO7S2/c1-27(22,23)14-7-10(3-5-13(14)26-15(16,17)18)28(24,25)19-8-9-2-4-11(20)12(21)6-9/h2-7,19-21H,8H2,1H3 |
| InChIKey | YPQWAQHFXYQBCF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|