C15H14F3NO5S2 — CID 67988371
N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfanyl-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 67988371) has the molecular formula C15H14F3NO5S2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfanyl-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfanyl-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 67988371 |
| Molecular Formula | C15H14F3NO5S2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methyl]-3-methylsulfanyl-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CSc1cc(S(=O)(=O)NCc2ccc(O)c(O)c2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C15H14F3NO5S2/c1-25-14-7-10(3-5-13(14)24-15(16,17)18)26(22,23)19-8-9-2-4-11(20)12(21)6-9/h2-7,19-21H,8H2,1H3 |
| InChIKey | PUTPINNXUXEJEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|