C29H32Cl2N2O3 — CID 67999252
tert-butyl 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(E,3S)-1-cyanopent-1-en-3-yl]-2-oxopiperidin-3-yl]acetate (PubChem CID 67999252) has the molecular formula C29H32Cl2N2O3 and a molecular weight of 527.49 g/mol. Its IUPAC name is tert-butyl 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(E,3S)-1-cyanopent-1-en-3-yl]-2-oxopiperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(E,3S)-1-cyanopent-1-en-3-yl]-2-oxopiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 67999252 |
| Molecular Formula | C29H32Cl2N2O3 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | tert-butyl 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(E,3S)-1-cyanopent-1-en-3-yl]-2-oxopiperidin-3-yl]acetate |
| SMILES | CCC(/C=C/C#N)N1C(=O)[C@@H](CC(=O)OC(C)(C)C)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32Cl2N2O3/c1-5-24(10-7-15-32)33-27(19-11-13-22(30)14-12-19)25(20-8-6-9-23(31)16-20)17-21(28(33)35)18-26(34)36-29(2,3)4/h6-14,16,21,24-25,27H,5,17-18H2,1-4H3/b10-7+/t21-,24?,25-,27-/m1/s1 |
| InChIKey | QAYDLFGXRHJEJO-WJAOOHEKSA-N |
| XLogP | 7.26 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|