C26H34CoN2O2 — CID 6821955
cobalt;bis(6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) (PubChem CID 6821955) has the molecular formula C26H34CoN2O2 and a molecular weight of 465.50 g/mol. Its IUPAC name is cobalt;bis(6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one).
| Compound Name | cobalt;bis(6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
|---|---|
| PubChem CID | 6821955 |
| Molecular Formula | C26H34CoN2O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | cobalt;bis(6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| SMILES | O=C1C=CC=CC1=CNC1CCCCC1.O=C1C=CC=CC1=CNC1CCCCC1.[Co] |
| InChI | InChI=1S/2C13H17NO.Co/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*4-6,9-10,12,14H,1-3,7-8H2; |
| InChIKey | LSMHJCOXFLSUAI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|