C30H22ClN5O5 — CID 6834607
N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[3-[(2-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-dien-1-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6834607) has the molecular formula C30H22ClN5O5 and a molecular weight of 567.99 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[3-[(2-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-dien-1-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[3-[(2-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-dien-1-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6834607 |
| Molecular Formula | C30H22ClN5O5 |
| Molecular Weight | 567.99 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[[3-[(2-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-dien-1-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C1C=CC(=NNc2ccccc2Cl)C=C1C=NNC(=O)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22ClN5O5/c31-23-8-4-5-9-24(23)35-34-22-11-12-26(37)21(16-22)17-32-36-30(39)25(33-29(38)20-6-2-1-3-7-20)14-19-10-13-27-28(15-19)41-18-40-27/h1-17,35H,18H2,(H,33,38)(H,36,39) |
| InChIKey | USDJIHBAUFEHAO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|