C29H40N2O6 — CID 68503954
tert-butyl 3-[2-[2-(2-acetamidoethyl)phenoxy]ethoxy]-4-(4-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 68503954) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(2-acetamidoethyl)phenoxy]ethoxy]-4-(4-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-(2-acetamidoethyl)phenoxy]ethoxy]-4-(4-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68503954 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | tert-butyl 3-[2-[2-(2-acetamidoethyl)phenoxy]ethoxy]-4-(4-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C2CCN(C(=O)OC(C)(C)C)CC2OCCOc2ccccc2CCNC(C)=O)cc1 |
| InChI | InChI=1S/C29H40N2O6/c1-21(32)30-16-14-23-8-6-7-9-26(23)35-18-19-36-27-20-31(28(33)37-29(2,3)4)17-15-25(27)22-10-12-24(34-5)13-11-22/h6-13,25,27H,14-20H2,1-5H3,(H,30,32) |
| InChIKey | WHEZGQFTCDLKRZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|