C28H36ClNO5 — CID 68501175
tert-butyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-prop-2-enoxypiperidine-1-carboxylate (PubChem CID 68501175) has the molecular formula C28H36ClNO5 and a molecular weight of 502.05 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-prop-2-enoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-prop-2-enoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68501175 |
| Molecular Formula | C28H36ClNO5 |
| Molecular Weight | 502.05 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | tert-butyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-prop-2-enoxypiperidine-1-carboxylate |
| SMILES | C=CCOC1CN(C(=O)OC(C)(C)C)CCC1c1ccc(OCCCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H36ClNO5/c1-5-17-33-26-20-30(27(31)35-28(2,3)4)16-15-23(26)21-11-13-22(14-12-21)32-18-8-19-34-25-10-7-6-9-24(25)29/h5-7,9-14,23,26H,1,8,15-20H2,2-4H3 |
| InChIKey | IWGBEKVQXOZKKW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.05 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|