C29H30O6 — CID 68507685
[4-(4-but-1-enoxybenzoyl)-1,4-dihydroxy-3-methylcyclohexa-2,5-dien-1-yl]-(4-but-1-enoxyphenyl)methanone (PubChem CID 68507685) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is [4-(4-but-1-enoxybenzoyl)-1,4-dihydroxy-3-methylcyclohexa-2,5-dien-1-yl]-(4-but-1-enoxyphenyl)methanone.
| Compound Name | [4-(4-but-1-enoxybenzoyl)-1,4-dihydroxy-3-methylcyclohexa-2,5-dien-1-yl]-(4-but-1-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 68507685 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [4-(4-but-1-enoxybenzoyl)-1,4-dihydroxy-3-methylcyclohexa-2,5-dien-1-yl]-(4-but-1-enoxyphenyl)methanone |
| SMILES | CCC=COc1ccc(C(=O)C2(O)C=CC(O)(C(=O)c3ccc(OC=CCC)cc3)C(C)=C2)cc1 |
| InChI | InChI=1S/C29H30O6/c1-4-6-18-34-24-12-8-22(9-13-24)26(30)28(32)16-17-29(33,21(3)20-28)27(31)23-10-14-25(15-11-23)35-19-7-5-2/h6-20,32-33H,4-5H2,1-3H3 |
| InChIKey | HCPXVVUHMUNMAL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|