About bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate
bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate (PubChem CID 68508851) has the molecular formula C18H26O8
and a molecular weight of 370.40 g/mol. Its IUPAC name is bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate |
| PubChem CID | 68508851 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate |
| SMILES | CCC(O)(OC(=O)c1ccc(C(=O)OC(O)(CC)C(C)O)cc1)C(C)O |
| InChI | InChI=1S/C18H26O8/c1-5-17(23,11(3)19)25-15(21)13-7-9-14(10-8-13)16(22)26-18(24,6-2)12(4)20/h7-12,19-20,23-24H,5-6H2,1-4H3 |
| InChIKey | PMDHPEXEMAJHIE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate?
The IUPAC name of bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate (CID 68508851) is bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate.
What is the SMILES notation for bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate?
The canonical SMILES for bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate is CCC(O)(OC(=O)c1ccc(C(=O)OC(O)(CC)C(C)O)cc1)C(C)O.
What is the InChIKey of bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate?
The InChIKey is PMDHPEXEMAJHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O8/c1-5-17(23,11(3)19)25-15(21)13-7-9-14(10-8-13)16(22)26-18(24,6-2)12(4)20/h7-12,19-20,23-24H,5-6H2,1-4H3.
What are the key properties of bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate?
bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate has a molecular weight of 370.40 g/mol, XLogP of 0.96, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate is sourced from PubChem (CID 68508851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).