C18H26O8 — CID 68508851
bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate (PubChem CID 68508851) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 68508851 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | bis(2,3-dihydroxypentan-3-yl) benzene-1,4-dicarboxylate |
| SMILES | CCC(O)(OC(=O)c1ccc(C(=O)OC(O)(CC)C(C)O)cc1)C(C)O |
| InChI | InChI=1S/C18H26O8/c1-5-17(23,11(3)19)25-15(21)13-7-9-14(10-8-13)16(22)26-18(24,6-2)12(4)20/h7-12,19-20,23-24H,5-6H2,1-4H3 |
| InChIKey | PMDHPEXEMAJHIE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|