C27H33N3O3 — CID 68533863
1-[2-(2-tert-butylphenoxy)-6-methoxy-3-pyridinyl]-3-(4-tert-butylphenyl)urea (PubChem CID 68533863) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-6-methoxy-3-pyridinyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-6-methoxy-3-pyridinyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 68533863 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-6-methoxy-3-pyridinyl]-3-(4-tert-butylphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(C(C)(C)C)cc2)c(Oc2ccccc2C(C)(C)C)n1 |
| InChI | InChI=1S/C27H33N3O3/c1-26(2,3)18-12-14-19(15-13-18)28-25(31)29-21-16-17-23(32-7)30-24(21)33-22-11-9-8-10-20(22)27(4,5)6/h8-17H,1-7H3,(H2,28,29,31) |
| InChIKey | WHNGYMNNZFPZGS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |