C23H21F4N3O3 — CID 151194648
1-[6-(2-tert-butylphenoxy)-2-(18F)fluoro-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 151194648) has the molecular formula C23H21F4N3O3 and a molecular weight of 462.43 g/mol. Its IUPAC name is 1-[6-(2-tert-butylphenoxy)-2-(18F)fluoro-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[6-(2-tert-butylphenoxy)-2-(18F)fluoro-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 151194648 |
| Molecular Formula | C23H21F4N3O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[6-(2-tert-butylphenoxy)-2-(18F)fluoro-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ccc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)c([18F])n1 |
| InChI | InChI=1S/C23H21F4N3O3/c1-22(2,3)16-6-4-5-7-18(16)32-19-13-12-17(20(24)30-19)29-21(31)28-14-8-10-15(11-9-14)33-23(25,26)27/h4-13H,1-3H3,(H2,28,29,31)/i24-1 |
| InChIKey | NHAORKFVAZPSNY-MIGPCILRSA-N |
| XLogP | 6.85 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|