C5H8N2O2S — CID 68534142
2-amino-2-methyl-3H-1,3-thiazole-4-carboxylic acid (PubChem CID 68534142) has the molecular formula C5H8N2O2S and a molecular weight of 160.20 g/mol. Its IUPAC name is 2-amino-2-methyl-3H-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-amino-2-methyl-3H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68534142 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 2-amino-2-methyl-3H-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(N)NC(C(=O)O)=CS1 |
| InChI | InChI=1S/C5H8N2O2S/c1-5(6)7-3(2-10-5)4(8)9/h2,7H,6H2,1H3,(H,8,9) |
| InChIKey | SZMHDWMUKANTCD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |