C28H31ClINO4 — CID 68539165
(3R,4R,4aR,7aR,12bS)-11-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide (PubChem CID 68539165) has the molecular formula C28H31ClINO4 and a molecular weight of 607.92 g/mol. Its IUPAC name is (3R,4R,4aR,7aR,12bS)-11-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide.
| Compound Name | (3R,4R,4aR,7aR,12bS)-11-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
|---|---|
| PubChem CID | 68539165 |
| Molecular Formula | C28H31ClINO4 |
| Molecular Weight | 607.92 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | (3R,4R,4aR,7aR,12bS)-11-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23c4c5c(OCc6ccc(Cl)cc6)cc(O)c4O[C@H]2C(=O)CC[C@H]3[C@H]1C5.[I-] |
| InChI | InChI=1S/C28H30ClNO4.HI/c1-30(14-16-2-3-16)11-10-28-20-8-9-22(31)27(28)34-26-23(32)13-24(19(25(26)28)12-21(20)30)33-15-17-4-6-18(29)7-5-17;/h4-7,13,16,20-21,27H,2-3,8-12,14-15H2,1H3;1H/t20-,21+,27-,28-,30+;/m0./s1 |
| InChIKey | RJOVTXRMVVARHD-FJFQATKBSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.92 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|