C16H23N5O2 — CID 68548838
6-[(2-amino-6-cyclohexylpyrimidin-4-yl)amino]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 68548838) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-[(2-amino-6-cyclohexylpyrimidin-4-yl)amino]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | 6-[(2-amino-6-cyclohexylpyrimidin-4-yl)amino]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 68548838 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 6-[(2-amino-6-cyclohexylpyrimidin-4-yl)amino]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | Nc1nc(NC2C3CN(C(=O)O)CC32)cc(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H23N5O2/c17-15-18-12(9-4-2-1-3-5-9)6-13(20-15)19-14-10-7-21(16(22)23)8-11(10)14/h6,9-11,14H,1-5,7-8H2,(H,22,23)(H3,17,18,19,20) |
| InChIKey | PZLDDFUDLBUSFA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |