C15H21N5O2 — CID 68543138
4-cyclohexyl-6-(6-nitro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-amine (PubChem CID 68543138) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-cyclohexyl-6-(6-nitro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-amine.
| Compound Name | 4-cyclohexyl-6-(6-nitro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 68543138 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-cyclohexyl-6-(6-nitro-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-2-amine |
| SMILES | Nc1nc(C2CCCCC2)cc(N2CC3C(C2)C3[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H21N5O2/c16-15-17-12(9-4-2-1-3-5-9)6-13(18-15)19-7-10-11(8-19)14(10)20(21)22/h6,9-11,14H,1-5,7-8H2,(H2,16,17,18) |
| InChIKey | TWPPIXDGGOJJLH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|