C22H18F3N3O2S2 — CID 68553773
1-dibenzothiophen-3-ylsulfonyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 68553773) has the molecular formula C22H18F3N3O2S2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 1-dibenzothiophen-3-ylsulfonyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-dibenzothiophen-3-ylsulfonyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 68553773 |
| Molecular Formula | C22H18F3N3O2S2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-dibenzothiophen-3-ylsulfonyl-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)sc1ccccc12)N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H18F3N3O2S2/c23-22(24,25)18-5-3-9-26-21(18)27-10-12-28(13-11-27)32(29,30)15-7-8-17-16-4-1-2-6-19(16)31-20(17)14-15/h1-9,14H,10-13H2 |
| InChIKey | NPIOOPRGHOIZMV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |