C17H28O4 — CID 68564506
4-butyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylic acid (PubChem CID 68564506) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-butyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylic acid.
| Compound Name | 4-butyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 68564506 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-butyl-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylic acid |
| SMILES | CCCCC1C(C)C(C(=O)O)CC2CCC(C(=O)O)CC21 |
| InChI | InChI=1S/C17H28O4/c1-3-4-5-13-10(2)14(17(20)21)8-11-6-7-12(16(18)19)9-15(11)13/h10-15H,3-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | WFOWXZWORCMFTR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |