C23H22F3NO5 — CID 68583120
3-[3-(2,2,4,7-tetramethyl-3-oxo-1,4-benzoxazin-6-yl)-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid (PubChem CID 68583120) has the molecular formula C23H22F3NO5 and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[3-(2,2,4,7-tetramethyl-3-oxo-1,4-benzoxazin-6-yl)-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(2,2,4,7-tetramethyl-3-oxo-1,4-benzoxazin-6-yl)-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68583120 |
| Molecular Formula | C23H22F3NO5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[3-(2,2,4,7-tetramethyl-3-oxo-1,4-benzoxazin-6-yl)-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc2c(cc1-c1cc(C=CC(=O)O)ccc1OCC(F)(F)F)N(C)C(=O)C(C)(C)O2 |
| InChI | InChI=1S/C23H22F3NO5/c1-13-9-19-17(27(4)21(30)22(2,3)32-19)11-15(13)16-10-14(6-8-20(28)29)5-7-18(16)31-12-23(24,25)26/h5-11H,12H2,1-4H3,(H,28,29) |
| InChIKey | LLUVXPMIEMZRJX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|