C21H23FN4O4 — CID 68593141
methyl (3S,3aR)-1-[2-amino-1-(methylamino)-2-oxoethyl]-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate (PubChem CID 68593141) has the molecular formula C21H23FN4O4 and a molecular weight of 414.44 g/mol. Its IUPAC name is methyl (3S,3aR)-1-[2-amino-1-(methylamino)-2-oxoethyl]-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate.
| Compound Name | methyl (3S,3aR)-1-[2-amino-1-(methylamino)-2-oxoethyl]-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 68593141 |
| Molecular Formula | C21H23FN4O4 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | methyl (3S,3aR)-1-[2-amino-1-(methylamino)-2-oxoethyl]-8-fluoro-3-phenyl-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
| SMILES | CNC(C(N)=O)N1C2c3cc(F)ccc3OC[C@H]2[C@@H](c2ccccc2)N1C(=O)OC |
| InChI | InChI=1S/C21H23FN4O4/c1-24-20(19(23)27)25-18-14-10-13(22)8-9-16(14)30-11-15(18)17(26(25)21(28)29-2)12-6-4-3-5-7-12/h3-10,15,17-18,20,24H,11H2,1-2H3,(H2,23,27)/t15-,17+,18?,20?/m0/s1 |
| InChIKey | ORDPDYUJGGYGKK-JQZVFVSYSA-N |
| XLogP | 1.95 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |