C21H22FN3O5 — CID 68593713
propan-2-yl (3S,3aR)-1-carbamoyl-8-fluoro-3-(3-hydroxyphenyl)-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate (PubChem CID 68593713) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is propan-2-yl (3S,3aR)-1-carbamoyl-8-fluoro-3-(3-hydroxyphenyl)-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate.
| Compound Name | propan-2-yl (3S,3aR)-1-carbamoyl-8-fluoro-3-(3-hydroxyphenyl)-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 68593713 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | propan-2-yl (3S,3aR)-1-carbamoyl-8-fluoro-3-(3-hydroxyphenyl)-3,3a,4,9b-tetrahydrochromeno[4,3-c]pyrazole-2-carboxylate |
| SMILES | CC(C)OC(=O)N1[C@H](c2cccc(O)c2)[C@@H]2COc3ccc(F)cc3C2N1C(N)=O |
| InChI | InChI=1S/C21H22FN3O5/c1-11(2)30-21(28)25-18(12-4-3-5-14(26)8-12)16-10-29-17-7-6-13(22)9-15(17)19(16)24(25)20(23)27/h3-9,11,16,18-19,26H,10H2,1-2H3,(H2,23,27)/t16-,18+,19?/m0/s1 |
| InChIKey | MCXPIXMCZVHOGA-CXEJCQMISA-N |
| XLogP | 3.48 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |