C27H30F3N3O3 — CID 68607021
4-[2-cyano-5-(trifluoromethyl)phenoxy]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide (PubChem CID 68607021) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is 4-[2-cyano-5-(trifluoromethyl)phenoxy]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[2-cyano-5-(trifluoromethyl)phenoxy]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 68607021 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[2-cyano-5-(trifluoromethyl)phenoxy]-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)C3CCC(Oc4cc(C(F)(F)F)ccc4C#N)CC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C27H30F3N3O3/c1-17-15-33(16-18(2)35-17)23-9-7-22(8-10-23)32-26(34)19-4-11-24(12-5-19)36-25-13-21(27(28,29)30)6-3-20(25)14-31/h3,6-10,13,17-19,24H,4-5,11-12,15-16H2,1-2H3,(H,32,34)/t17-,18+,19?,24? |
| InChIKey | XFBXWXXATGSMIO-SZKUSEGLSA-N |
| XLogP | 5.77 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|