C30H42BrN3O4S — CID 68614261
hexyl 5-[2-(1-benzylpiperidin-4-yl)ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate (PubChem CID 68614261) has the molecular formula C30H42BrN3O4S and a molecular weight of 620.65 g/mol. Its IUPAC name is hexyl 5-[2-(1-benzylpiperidin-4-yl)ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate.
| Compound Name | hexyl 5-[2-(1-benzylpiperidin-4-yl)ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 68614261 |
| Molecular Formula | C30H42BrN3O4S |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | hexyl 5-[2-(1-benzylpiperidin-4-yl)ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate |
| SMILES | CCCCCCOC(=O)C(CCC(=O)NCCC1CCN(Cc2ccccc2)CC1)NC(=O)c1cc(Br)cs1 |
| InChI | InChI=1S/C30H42BrN3O4S/c1-2-3-4-8-19-38-30(37)26(33-29(36)27-20-25(31)22-39-27)11-12-28(35)32-16-13-23-14-17-34(18-15-23)21-24-9-6-5-7-10-24/h5-7,9-10,20,22-23,26H,2-4,8,11-19,21H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | RRISCGLVYBLGLP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|