C30H42BrN3O4S — CID 90897120
hexyl 5-[(1-benzylpiperidin-4-yl)-ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate (PubChem CID 90897120) has the molecular formula C30H42BrN3O4S and a molecular weight of 620.65 g/mol. Its IUPAC name is hexyl 5-[(1-benzylpiperidin-4-yl)-ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate.
| Compound Name | hexyl 5-[(1-benzylpiperidin-4-yl)-ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 90897120 |
| Molecular Formula | C30H42BrN3O4S |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | hexyl 5-[(1-benzylpiperidin-4-yl)-ethylamino]-2-[(4-bromothiophene-2-carbonyl)amino]-5-oxopentanoate |
| SMILES | CCCCCCOC(=O)C(CCC(=O)N(CC)C1CCN(Cc2ccccc2)CC1)NC(=O)c1cc(Br)cs1 |
| InChI | InChI=1S/C30H42BrN3O4S/c1-3-5-6-10-19-38-30(37)26(32-29(36)27-20-24(31)22-39-27)13-14-28(35)34(4-2)25-15-17-33(18-16-25)21-23-11-8-7-9-12-23/h7-9,11-12,20,22,25-26H,3-6,10,13-19,21H2,1-2H3,(H,32,36) |
| InChIKey | KIXNXKDYZLMRGP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|