C19H21ClO4 — CID 68616300
methyl (2S)-3-(2-chloro-4-phenylmethoxyphenyl)-2-ethoxypropanoate (PubChem CID 68616300) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is methyl (2S)-3-(2-chloro-4-phenylmethoxyphenyl)-2-ethoxypropanoate.
| Compound Name | methyl (2S)-3-(2-chloro-4-phenylmethoxyphenyl)-2-ethoxypropanoate |
|---|---|
| PubChem CID | 68616300 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl (2S)-3-(2-chloro-4-phenylmethoxyphenyl)-2-ethoxypropanoate |
| SMILES | CCO[C@@H](Cc1ccc(OCc2ccccc2)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C19H21ClO4/c1-3-23-18(19(21)22-2)11-15-9-10-16(12-17(15)20)24-13-14-7-5-4-6-8-14/h4-10,12,18H,3,11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | PDYNGRHQWBHGTG-SFHVURJKSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |