C18H24N2O6 — CID 68618799
2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4,4-dimethylpentanoic acid (PubChem CID 68618799) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 68618799 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(C(=O)O)N1C(=O)NC(c2ccc(OCCO)cc2)C1=O |
| InChI | InChI=1S/C18H24N2O6/c1-18(2,3)10-13(16(23)24)20-15(22)14(19-17(20)25)11-4-6-12(7-5-11)26-9-8-21/h4-7,13-14,21H,8-10H2,1-3H3,(H,19,25)(H,23,24) |
| InChIKey | JOTVFMGVRQFOJF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|