C33H36N5S2+ — CID 68619141
10-(1,1-dimethyl-9-pyrido[4,3-b][1,4]benzothiazin-10-ylazecan-1-ium-3-yl)pyrido[4,3-b][1,4]benzothiazine (PubChem CID 68619141) has the molecular formula C33H36N5S2+ and a molecular weight of 566.82 g/mol. Its IUPAC name is 10-(1,1-dimethyl-9-pyrido[4,3-b][1,4]benzothiazin-10-ylazecan-1-ium-3-yl)pyrido[4,3-b][1,4]benzothiazine.
| Compound Name | 10-(1,1-dimethyl-9-pyrido[4,3-b][1,4]benzothiazin-10-ylazecan-1-ium-3-yl)pyrido[4,3-b][1,4]benzothiazine |
|---|---|
| PubChem CID | 68619141 |
| Molecular Formula | C33H36N5S2+ |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 10-(1,1-dimethyl-9-pyrido[4,3-b][1,4]benzothiazin-10-ylazecan-1-ium-3-yl)pyrido[4,3-b][1,4]benzothiazine |
| SMILES | C[N+]1(C)CC(N2c3ccccc3Sc3ccncc32)CCCCCC(N2c3ccccc3Sc3ccncc32)C1 |
| InChI | InChI=1S/C33H36N5S2/c1-38(2)22-24(36-26-12-6-8-14-30(26)39-32-16-18-34-20-28(32)36)10-4-3-5-11-25(23-38)37-27-13-7-9-15-31(27)40-33-17-19-35-21-29(33)37/h6-9,12-21,24-25H,3-5,10-11,22-23H2,1-2H3/q+1 |
| InChIKey | JORWXBNLLVPBJZ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|