C31H28S4+2 — CID 102379105
5-[(1S,2S)-2-thianthren-5-ium-5-ylcycloheptyl]thianthren-5-ium (PubChem CID 102379105) has the molecular formula C31H28S4+2 and a molecular weight of 528.83 g/mol. Its IUPAC name is 5-[(1S,2S)-2-thianthren-5-ium-5-ylcycloheptyl]thianthren-5-ium.
| Compound Name | 5-[(1S,2S)-2-thianthren-5-ium-5-ylcycloheptyl]thianthren-5-ium |
|---|---|
| PubChem CID | 102379105 |
| Molecular Formula | C31H28S4+2 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 5-[(1S,2S)-2-thianthren-5-ium-5-ylcycloheptyl]thianthren-5-ium |
| SMILES | c1ccc2c(c1)Sc1ccccc1[S+]2[C@H]1CCCCC[C@@H]1[S+]1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C31H28S4/c1-2-20-30(34-26-16-8-4-12-22(26)32-23-13-5-9-17-27(23)34)31(21-3-1)35-28-18-10-6-14-24(28)33-25-15-7-11-19-29(25)35/h4-19,30-31H,1-3,20-21H2/q+2/t30-,31-/m0/s1 |
| InChIKey | SOBMFLSVHQUJTL-CONSDPRKSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|