C17H16S2+2 — CID 10814674
1,8-dithioniapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene (PubChem CID 10814674) has the molecular formula C17H16S2+2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1,8-dithioniapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 1,8-dithioniapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10814674 |
| Molecular Formula | C17H16S2+2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1,8-dithioniapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene |
| SMILES | c1ccc2c(c1)[S+]1c3ccccc3[S+]2C2CCCC21 |
| InChI | InChI=1S/C17H16S2/c1-2-7-13-12(6-1)18-14-8-3-4-9-15(14)19(13)17-11-5-10-16(17)18/h1-4,6-9,16-17H,5,10-11H2/q+2 |
| InChIKey | UQVXUIODRRRRCJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|