C18H18S2+2 — CID 10929152
1,8-dithioniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13-hexaene (PubChem CID 10929152) has the molecular formula C18H18S2+2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 1,8-dithioniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13-hexaene.
| Compound Name | 1,8-dithioniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10929152 |
| Molecular Formula | C18H18S2+2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1,8-dithioniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13-hexaene |
| SMILES | c1ccc2c(c1)[S+]1c3ccccc3[S+]2C2CCCCC21 |
| InChI | InChI=1S/C18H18S2/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-3,5,7-9,11,16,18H,4,6,10,12H2/q+2 |
| InChIKey | DCUQHMWVPKDNRT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|