C19H20F12S2Sb2 — CID 16689515
1,9-dithioniapentacyclo[7.6.6.02,8.010,15.016,21]henicosa-10,12,14,16,18,20-hexaene;bis(hexafluoroantimony(1-)) (PubChem CID 16689515) has the molecular formula C19H20F12S2Sb2 and a molecular weight of 784.00 g/mol. Its IUPAC name is 1,9-dithioniapentacyclo[7.6.6.02,8.010,15.016,21]henicosa-10,12,14,16,18,20-hexaene;bis(hexafluoroantimony(1-)).
| Compound Name | 1,9-dithioniapentacyclo[7.6.6.02,8.010,15.016,21]henicosa-10,12,14,16,18,20-hexaene;bis(hexafluoroantimony(1-)) |
|---|---|
| PubChem CID | 16689515 |
| Molecular Formula | C19H20F12S2Sb2 |
| Molecular Weight | 784.00 g/mol |
| Exact Mass | 781.89 |
| IUPAC Name | 1,9-dithioniapentacyclo[7.6.6.02,8.010,15.016,21]henicosa-10,12,14,16,18,20-hexaene;bis(hexafluoroantimony(1-)) |
| SMILES | F[Sb-](F)(F)(F)(F)F.F[Sb-](F)(F)(F)(F)F.c1ccc2c(c1)[S+]1c3ccccc3[S+]2C2CCCCCC21 |
| InChI | InChI=1S/C19H20S2.12FH.2Sb/c1-2-8-14-15(9-3-1)21-18-12-6-4-10-16(18)20(14)17-11-5-7-13-19(17)21;;;;;;;;;;;;;;/h4-7,10-15H,1-3,8-9H2;12*1H;;/q+2;;;;;;;;;;;;;2*+5/p-12 |
| InChIKey | RBMJTCXLOWEGPQ-UHFFFAOYSA-B |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.00 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|