C16H18N6O — CID 68620408
1-(oxan-4-yl)-5-[6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-2H-pyrazine (PubChem CID 68620408) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(oxan-4-yl)-5-[6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-2H-pyrazine.
| Compound Name | 1-(oxan-4-yl)-5-[6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-2H-pyrazine |
|---|---|
| PubChem CID | 68620408 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(oxan-4-yl)-5-[6-(1H-1,2,4-triazol-5-yl)-3-pyridinyl]-2H-pyrazine |
| SMILES | C1=NC(c2ccc(-c3ncn[nH]3)nc2)=CN(C2CCOCC2)C1 |
| InChI | InChI=1S/C16H18N6O/c1-2-14(16-19-11-20-21-16)18-9-12(1)15-10-22(6-5-17-15)13-3-7-23-8-4-13/h1-2,5,9-11,13H,3-4,6-8H2,(H,19,20,21) |
| InChIKey | HGWQEJPEXQNUHZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |