C16H19O5Si — CID 68622767
CID 68622767 (PubChem CID 68622767) has the molecular formula C16H19O5Si and a molecular weight of 319.41 g/mol.
| Compound Name | CID 68622767 |
|---|---|
| PubChem CID | 68622767 |
| Molecular Formula | C16H19O5Si |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(OC(=O)OC2([Si])CCCCO2)c(OC)c1 |
| InChI | InChI=1S/C16H19O5Si/c1-3-6-12-7-8-13(14(11-12)18-2)20-15(17)21-16(22)9-4-5-10-19-16/h3,7-8,11H,1,4-6,9-10H2,2H3 |
| InChIKey | HSCHZZAKUDZTQA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|