C14H19O3Si — CID 70184133
CID 70184133 (PubChem CID 70184133) has the molecular formula C14H19O3Si and a molecular weight of 263.39 g/mol.
| Compound Name | CID 70184133 |
|---|---|
| PubChem CID | 70184133 |
| Molecular Formula | C14H19O3Si |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(O[Si]2CCCCO2)c(OC)c1 |
| InChI | InChI=1S/C14H19O3Si/c1-3-6-12-7-8-13(14(11-12)15-2)17-18-10-5-4-9-16-18/h3,7-8,11H,1,4-6,9-10H2,2H3 |
| InChIKey | SRXSSPJERCVNAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|