C17H25FN4O2 — CID 68632317
3-[4-(2-amino-5-fluoroanilino)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylic acid (PubChem CID 68632317) has the molecular formula C17H25FN4O2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[4-(2-amino-5-fluoroanilino)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylic acid.
| Compound Name | 3-[4-(2-amino-5-fluoroanilino)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68632317 |
| Molecular Formula | C17H25FN4O2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[4-(2-amino-5-fluoroanilino)piperidin-1-yl]-3-methylpyrrolidine-1-carboxylic acid |
| SMILES | CC1(N2CCC(Nc3cc(F)ccc3N)CC2)CCN(C(=O)O)C1 |
| InChI | InChI=1S/C17H25FN4O2/c1-17(6-9-21(11-17)16(23)24)22-7-4-13(5-8-22)20-15-10-12(18)2-3-14(15)19/h2-3,10,13,20H,4-9,11,19H2,1H3,(H,23,24) |
| InChIKey | KSDKDNLLNLNURY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|