About 3,3-dipentylpyrazole
3,3-dipentylpyrazole (PubChem CID 68635584) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 3,3-dipentylpyrazole.
Molecular Properties
| Compound Name | 3,3-dipentylpyrazole |
| PubChem CID | 68635584 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3,3-dipentylpyrazole |
| SMILES | CCCCCC1(CCCCC)C=CN=N1 |
| InChI | InChI=1S/C13H24N2/c1-3-5-7-9-13(10-8-6-4-2)11-12-14-15-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | AJHJASZIQCQCKM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dipentylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dipentylpyrazole?
The IUPAC name of 3,3-dipentylpyrazole (CID 68635584) is 3,3-dipentylpyrazole.
What is the SMILES notation for 3,3-dipentylpyrazole?
The canonical SMILES for 3,3-dipentylpyrazole is CCCCCC1(CCCCC)C=CN=N1.
What is the InChIKey of 3,3-dipentylpyrazole?
The InChIKey is AJHJASZIQCQCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-3-5-7-9-13(10-8-6-4-2)11-12-14-15-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 3,3-dipentylpyrazole?
3,3-dipentylpyrazole has a molecular weight of 208.35 g/mol, XLogP of 4.87, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dipentylpyrazole is sourced from PubChem (CID 68635584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).