C24H40O5 — CID 68639087
3-methyl-6-[(Z)-2-oxononadec-10-enyl]-1,4-dioxane-2,5-dione (PubChem CID 68639087) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 3-methyl-6-[(Z)-2-oxononadec-10-enyl]-1,4-dioxane-2,5-dione.
| Compound Name | 3-methyl-6-[(Z)-2-oxononadec-10-enyl]-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 68639087 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 3-methyl-6-[(Z)-2-oxononadec-10-enyl]-1,4-dioxane-2,5-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC1OC(=O)C(C)OC1=O |
| InChI | InChI=1S/C24H40O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(25)19-22-24(27)28-20(2)23(26)29-22/h10-11,20,22H,3-9,12-19H2,1-2H3/b11-10- |
| InChIKey | QBYNKMMUGXORQL-KHPPLWFESA-N |
| XLogP | 5.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|