C14H17N5 — CID 68639972
3-[2-(1H-indol-3-yl)ethyl]-2H-pyrazine-2,3-diamine (PubChem CID 68639972) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethyl]-2H-pyrazine-2,3-diamine.
| Compound Name | 3-[2-(1H-indol-3-yl)ethyl]-2H-pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 68639972 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethyl]-2H-pyrazine-2,3-diamine |
| SMILES | NC1N=CC=NC1(N)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17N5/c15-13-14(16,19-8-7-17-13)6-5-10-9-18-12-4-2-1-3-11(10)12/h1-4,7-9,13,18H,5-6,15-16H2 |
| InChIKey | VQZAPOVWHFFLTE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |