C17H22Cl2FN5O3 — CID 68652587
4-[[2-[2-(2-fluoro-4,5-dimethoxyphenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;dihydrochloride (PubChem CID 68652587) has the molecular formula C17H22Cl2FN5O3 and a molecular weight of 434.30 g/mol. Its IUPAC name is 4-[[2-[2-(2-fluoro-4,5-dimethoxyphenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[[2-[2-(2-fluoro-4,5-dimethoxyphenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 68652587 |
| Molecular Formula | C17H22Cl2FN5O3 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[[2-[2-(2-fluoro-4,5-dimethoxyphenyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(NCC(=O)NNc2cc(OC)c(OC)cc2F)cc1 |
| InChI | InChI=1S/C17H20FN5O3.2ClH/c1-25-14-7-12(18)13(8-15(14)26-2)22-23-16(24)9-21-11-5-3-10(4-6-11)17(19)20;;/h3-8,21-22H,9H2,1-2H3,(H3,19,20)(H,23,24);2*1H |
| InChIKey | BGSOPDQFUOULBG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|