C29H26F3N5O7 — CID 68652655
[1-(4-carbamimidoylanilino)-2-[(1,3-dioxoisoindol-2-yl)amino]-1-(3-methoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 68652655) has the molecular formula C29H26F3N5O7 and a molecular weight of 613.55 g/mol. Its IUPAC name is [1-(4-carbamimidoylanilino)-2-[(1,3-dioxoisoindol-2-yl)amino]-1-(3-methoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(4-carbamimidoylanilino)-2-[(1,3-dioxoisoindol-2-yl)amino]-1-(3-methoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68652655 |
| Molecular Formula | C29H26F3N5O7 |
| Molecular Weight | 613.55 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | [1-(4-carbamimidoylanilino)-2-[(1,3-dioxoisoindol-2-yl)amino]-1-(3-methoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(OC(=O)C(F)(F)F)(C(=O)NN2C(=O)c3ccccc3C2=O)c2ccc(OC(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H26F3N5O7/c1-15(2)43-21-13-10-17(14-22(21)42-3)28(44-27(41)29(30,31)32,35-18-11-8-16(9-12-18)23(33)34)26(40)36-37-24(38)19-6-4-5-7-20(19)25(37)39/h4-15,35H,1-3H3,(H3,33,34)(H,36,40) |
| InChIKey | WUKZOLAOSPHHKG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 173.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|