C32H30Cl2N4O5 — CID 57047196
[2-(benzylamino)-1-(4-carbamimidoylanilino)-1-[4-[(3,5-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-oxoethyl] acetate (PubChem CID 57047196) has the molecular formula C32H30Cl2N4O5 and a molecular weight of 621.52 g/mol. Its IUPAC name is [2-(benzylamino)-1-(4-carbamimidoylanilino)-1-[4-[(3,5-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-oxoethyl] acetate.
| Compound Name | [2-(benzylamino)-1-(4-carbamimidoylanilino)-1-[4-[(3,5-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 57047196 |
| Molecular Formula | C32H30Cl2N4O5 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | [2-(benzylamino)-1-(4-carbamimidoylanilino)-1-[4-[(3,5-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-oxoethyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(OC(C)=O)(C(=O)NCc2ccccc2)c2ccc(OCc3cc(Cl)cc(Cl)c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H30Cl2N4O5/c1-20(39)43-32(31(40)37-18-21-6-4-3-5-7-21,38-27-11-8-23(9-12-27)30(35)36)24-10-13-28(29(16-24)41-2)42-19-22-14-25(33)17-26(34)15-22/h3-17,38H,18-19H2,1-2H3,(H3,35,36)(H,37,40) |
| InChIKey | UNWMUNYBCWPLID-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|