C32H34F3N3O6S — CID 67446118
[1-(4-carbamimidoylphenoxy)-2-[(2-cyclopropylsulfanylphenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 67446118) has the molecular formula C32H34F3N3O6S and a molecular weight of 645.70 g/mol. Its IUPAC name is [1-(4-carbamimidoylphenoxy)-2-[(2-cyclopropylsulfanylphenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(4-carbamimidoylphenoxy)-2-[(2-cyclopropylsulfanylphenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67446118 |
| Molecular Formula | C32H34F3N3O6S |
| Molecular Weight | 645.70 g/mol |
| Exact Mass | 645.21 |
| IUPAC Name | [1-(4-carbamimidoylphenoxy)-2-[(2-cyclopropylsulfanylphenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(OC(OC(=O)C(F)(F)F)(C(=O)NCc2ccccc2SC2CC2)c2ccc(OC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C32H34F3N3O6S/c1-4-41-26-17-22(11-16-25(26)42-19(2)3)31(44-30(40)32(33,34)35,43-23-12-9-20(10-13-23)28(36)37)29(39)38-18-21-7-5-6-8-27(21)45-24-14-15-24/h5-13,16-17,19,24H,4,14-15,18H2,1-3H3,(H3,36,37)(H,38,39) |
| InChIKey | FFFFTPKVAUBCSW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|