C18H26NO4P — CID 68667068
[(1R,9R,10R)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl] dihydrogen phosphate (PubChem CID 68667068) has the molecular formula C18H26NO4P and a molecular weight of 351.38 g/mol. Its IUPAC name is [(1R,9R,10R)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl] dihydrogen phosphate.
| Compound Name | [(1R,9R,10R)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 68667068 |
| Molecular Formula | C18H26NO4P |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [(1R,9R,10R)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl] dihydrogen phosphate |
| SMILES | Cc1cc(OP(=O)(O)O)c2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C18H26NO4P/c1-12-9-15-13(17(10-12)23-24(20,21)22)11-16-14-5-3-4-6-18(14,15)7-8-19(16)2/h9-10,14,16H,3-8,11H2,1-2H3,(H2,20,21,22)/t14-,16+,18+/m0/s1 |
| InChIKey | UAMFWGAVGUOFOD-YXJHDRRASA-N |
| XLogP | 3.15 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|