C23H22NO6S- — CID 68692554
1-(carboxymethyl)-2-[2-[4-(4-methyl-N-sulfinatoanilino)phenoxy]ethoxy]benzene (PubChem CID 68692554) has the molecular formula C23H22NO6S- and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-(carboxymethyl)-2-[2-[4-(4-methyl-N-sulfinatoanilino)phenoxy]ethoxy]benzene.
| Compound Name | 1-(carboxymethyl)-2-[2-[4-(4-methyl-N-sulfinatoanilino)phenoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 68692554 |
| Molecular Formula | C23H22NO6S- |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-(carboxymethyl)-2-[2-[4-(4-methyl-N-sulfinatoanilino)phenoxy]ethoxy]benzene |
| SMILES | Cc1ccc(N(c2ccc(OCCOc3ccccc3CC(=O)O)cc2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C23H23NO6S/c1-17-6-8-19(9-7-17)24(31(27)28)20-10-12-21(13-11-20)29-14-15-30-22-5-3-2-4-18(22)16-23(25)26/h2-13H,14-16H2,1H3,(H,25,26)(H,27,28)/p-1 |
| InChIKey | OROWDLICWICYFJ-UHFFFAOYSA-M |
| XLogP | 4.01 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|