C27H28Cl4N4O4S — CID 68695452
6-[(3,4-dichlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 68695452) has the molecular formula C27H28Cl4N4O4S and a molecular weight of 646.42 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-[(3,4-dichlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 68695452 |
| Molecular Formula | C27H28Cl4N4O4S |
| Molecular Weight | 646.42 g/mol |
| Exact Mass | 644.06 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrolidin-1-yl-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1C=C2N(C(=O)C(N3CCCC3)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C27H28Cl4N4O4S/c1-16(2)33-15-25-34(40(38,39)24-8-6-18(28)13-21(24)31)14-23(32-9-3-4-10-32)27(37)35(25)22(26(33)36)12-17-5-7-19(29)20(30)11-17/h5-8,11,13,15-16,22-23H,3-4,9-10,12,14H2,1-2H3 |
| InChIKey | JMSGLHDEZPQANK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |