C22H26O6 — CID 68706007
8-(methoxymethoxy)-4-[4-(methoxymethoxy)phenyl]-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-2-ol (PubChem CID 68706007) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 8-(methoxymethoxy)-4-[4-(methoxymethoxy)phenyl]-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-2-ol.
| Compound Name | 8-(methoxymethoxy)-4-[4-(methoxymethoxy)phenyl]-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-2-ol |
|---|---|
| PubChem CID | 68706007 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 8-(methoxymethoxy)-4-[4-(methoxymethoxy)phenyl]-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-2-ol |
| SMILES | COCOc1ccc(C2Oc3ccc(OCOC)cc3C3CC(O)CC32)cc1 |
| InChI | InChI=1S/C22H26O6/c1-24-12-26-16-5-3-14(4-6-16)22-20-10-15(23)9-18(20)19-11-17(27-13-25-2)7-8-21(19)28-22/h3-8,11,15,18,20,22-23H,9-10,12-13H2,1-2H3 |
| InChIKey | QZPYEMWSXOMGAC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|