C20H18O3 — CID 72756627
2-ethynyl-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol (PubChem CID 72756627) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-ethynyl-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol.
| Compound Name | 2-ethynyl-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
|---|---|
| PubChem CID | 72756627 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-ethynyl-4-(4-hydroxyphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
| SMILES | C#CC1CC2c3cc(O)ccc3OC(c3ccc(O)cc3)C2C1 |
| InChI | InChI=1S/C20H18O3/c1-2-12-9-16-17-11-15(22)7-8-19(17)23-20(18(16)10-12)13-3-5-14(21)6-4-13/h1,3-8,11-12,16,18,20-22H,9-10H2 |
| InChIKey | PLRDVEMFZFYUOT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|