C21H24O2 — CID 58862336
(3aR,4S,9bR)-1,1-dimethyl-4-(4-methylphenyl)-3,3a,4,9b-tetrahydro-2H-cyclopenta[c]chromen-8-ol (PubChem CID 58862336) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (3aR,4S,9bR)-1,1-dimethyl-4-(4-methylphenyl)-3,3a,4,9b-tetrahydro-2H-cyclopenta[c]chromen-8-ol.
| Compound Name | (3aR,4S,9bR)-1,1-dimethyl-4-(4-methylphenyl)-3,3a,4,9b-tetrahydro-2H-cyclopenta[c]chromen-8-ol |
|---|---|
| PubChem CID | 58862336 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3aR,4S,9bR)-1,1-dimethyl-4-(4-methylphenyl)-3,3a,4,9b-tetrahydro-2H-cyclopenta[c]chromen-8-ol |
| SMILES | Cc1ccc([C@H]2Oc3ccc(O)cc3[C@@H]3[C@H]2CCC3(C)C)cc1 |
| InChI | InChI=1S/C21H24O2/c1-13-4-6-14(7-5-13)20-16-10-11-21(2,3)19(16)17-12-15(22)8-9-18(17)23-20/h4-9,12,16,19-20,22H,10-11H2,1-3H3/t16-,19+,20-/m1/s1 |
| InChIKey | BBCSOXSAXXENIN-LSTHTHJFSA-N |
| XLogP | 5.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |