C12H13N — CID 68707064
3-(2,3-dihydro-1H-inden-1-yl)prop-2-yn-1-amine (PubChem CID 68707064) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-1-yl)prop-2-yn-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-1-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 68707064 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-1-yl)prop-2-yn-1-amine |
| SMILES | NCC#CC1CCc2ccccc21 |
| InChI | InChI=1S/C12H13N/c13-9-3-5-11-8-7-10-4-1-2-6-12(10)11/h1-2,4,6,11H,7-9,13H2 |
| InChIKey | IFUFZGKEPPALFW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|