C25H32N2O4 — CID 68712964
ethyl 4-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-4-oxo-3-pyridin-2-ylbutanoate (PubChem CID 68712964) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl 4-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-4-oxo-3-pyridin-2-ylbutanoate.
| Compound Name | ethyl 4-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-4-oxo-3-pyridin-2-ylbutanoate |
|---|---|
| PubChem CID | 68712964 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | ethyl 4-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-4-oxo-3-pyridin-2-ylbutanoate |
| SMILES | CCOC(=O)CC(C(=O)c1ccc(OCCCN2CCCC2C)cc1)c1ccccn1 |
| InChI | InChI=1S/C25H32N2O4/c1-3-30-24(28)18-22(23-9-4-5-14-26-23)25(29)20-10-12-21(13-11-20)31-17-7-16-27-15-6-8-19(27)2/h4-5,9-14,19,22H,3,6-8,15-18H2,1-2H3 |
| InChIKey | DVPGXFZHFPYRKF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|