C24H20N4 — CID 68718997
2,3,5,7-tetramethylporphyrin (PubChem CID 68718997) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2,3,5,7-tetramethylporphyrin.
| Compound Name | 2,3,5,7-tetramethylporphyrin |
|---|---|
| PubChem CID | 68718997 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2,3,5,7-tetramethylporphyrin |
| SMILES | CC1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/C)C1=N2)C(C)=C5C)C=C4)C=C3 |
| InChI | InChI=1S/C24H20N4/c1-13-9-21-11-19-6-5-17(25-19)10-18-7-8-20(26-18)12-22-14(2)15(3)24(28-22)16(4)23(13)27-21/h5-12H,1-4H3/b17-10-,18-10-,19-11-,20-12-,21-11-,22-12-,23-16-,24-16- |
| InChIKey | UUTUHBMYMLXHJJ-WGIJGKSOSA-N |
| XLogP | 5.14 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |